C19H16Cl4N4O8 — CID 99641045
2-(2,4-dichloro-6-nitrophenoxy)-N-[(2S)-2-[[2-(2,4-dichloro-6-nitrophenoxy)acetyl]amino]propyl]acetamide (PubChem CID 99641045) has the molecular formula C19H16Cl4N4O8 and a molecular weight of 570.17 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-nitrophenoxy)-N-[(2S)-2-[[2-(2,4-dichloro-6-nitrophenoxy)acetyl]amino]propyl]acetamide.
| Compound Name | 2-(2,4-dichloro-6-nitrophenoxy)-N-[(2S)-2-[[2-(2,4-dichloro-6-nitrophenoxy)acetyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 99641045 |
| Molecular Formula | C19H16Cl4N4O8 |
| Molecular Weight | 570.17 g/mol |
| Exact Mass | 567.97 |
| IUPAC Name | 2-(2,4-dichloro-6-nitrophenoxy)-N-[(2S)-2-[[2-(2,4-dichloro-6-nitrophenoxy)acetyl]amino]propyl]acetamide |
| SMILES | C[C@@H](CNC(=O)COc1c(Cl)cc(Cl)cc1[N+](=O)[O-])NC(=O)COc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16Cl4N4O8/c1-9(25-17(29)8-35-19-13(23)3-11(21)5-15(19)27(32)33)6-24-16(28)7-34-18-12(22)2-10(20)4-14(18)26(30)31/h2-5,9H,6-8H2,1H3,(H,24,28)(H,25,29)/t9-/m0/s1 |
| InChIKey | VKUBMYUPHFHGCV-VIFPVBQESA-N |
| XLogP | 4.20 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|