C12H17ClFN3O4 — CID 120829431
2-(3-fluoro-4-nitrophenoxy)-N-[2-(methylamino)propyl]acetamide;hydrochloride (PubChem CID 120829431) has the molecular formula C12H17ClFN3O4 and a molecular weight of 321.74 g/mol. Its IUPAC name is 2-(3-fluoro-4-nitrophenoxy)-N-[2-(methylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-(3-fluoro-4-nitrophenoxy)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120829431 |
| Molecular Formula | C12H17ClFN3O4 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(3-fluoro-4-nitrophenoxy)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)COc1ccc([N+](=O)[O-])c(F)c1.Cl |
| InChI | InChI=1S/C12H16FN3O4.ClH/c1-8(14-2)6-15-12(17)7-20-9-3-4-11(16(18)19)10(13)5-9;/h3-5,8,14H,6-7H2,1-2H3,(H,15,17);1H |
| InChIKey | AGSVHHKMCODSMB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|