C13H17ClFN3O5 — CID 120946560
2-(3-fluoro-4-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]acetamide;hydrochloride (PubChem CID 120946560) has the molecular formula C13H17ClFN3O5 and a molecular weight of 349.75 g/mol. Its IUPAC name is 2-(3-fluoro-4-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(3-fluoro-4-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120946560 |
| Molecular Formula | C13H17ClFN3O5 |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(3-fluoro-4-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(COc1ccc([N+](=O)[O-])c(F)c1)NCC1CNCC1O |
| InChI | InChI=1S/C13H16FN3O5.ClH/c14-10-3-9(1-2-11(10)17(20)21)22-7-13(19)16-5-8-4-15-6-12(8)18;/h1-3,8,12,15,18H,4-7H2,(H,16,19);1H |
| InChIKey | MYYNPNCVCNXRMS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|