C10H8FN3O4 — CID 78989504
N-(cyanomethyl)-2-(3-fluoro-4-nitrophenoxy)acetamide (PubChem CID 78989504) has the molecular formula C10H8FN3O4 and a molecular weight of 253.19 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(3-fluoro-4-nitrophenoxy)acetamide.
| Compound Name | N-(cyanomethyl)-2-(3-fluoro-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 78989504 |
| Molecular Formula | C10H8FN3O4 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-(cyanomethyl)-2-(3-fluoro-4-nitrophenoxy)acetamide |
| SMILES | N#CCNC(=O)COc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C10H8FN3O4/c11-8-5-7(1-2-9(8)14(16)17)18-6-10(15)13-4-3-12/h1-2,5H,4,6H2,(H,13,15) |
| InChIKey | UMOOUMUSYPYABF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|