C14H18ClN3O5 — CID 120943628
3-(4-chloro-2-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide (PubChem CID 120943628) has the molecular formula C14H18ClN3O5 and a molecular weight of 343.77 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide.
| Compound Name | 3-(4-chloro-2-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 120943628 |
| Molecular Formula | C14H18ClN3O5 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-(4-chloro-2-nitrophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide |
| SMILES | O=C(CCOc1ccc(Cl)cc1[N+](=O)[O-])NCC1CNCC1O |
| InChI | InChI=1S/C14H18ClN3O5/c15-10-1-2-13(11(5-10)18(21)22)23-4-3-14(20)17-7-9-6-16-8-12(9)19/h1-2,5,9,12,16,19H,3-4,6-8H2,(H,17,20) |
| InChIKey | SXBJHAOWKLCZJC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|