C16H19ClN2O6 — CID 122113506
1-[3-(4-chloro-2-nitrophenoxy)propanoyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122113506) has the molecular formula C16H19ClN2O6 and a molecular weight of 370.79 g/mol. Its IUPAC name is 1-[3-(4-chloro-2-nitrophenoxy)propanoyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-2-nitrophenoxy)propanoyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113506 |
| Molecular Formula | C16H19ClN2O6 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[3-(4-chloro-2-nitrophenoxy)propanoyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)CN1C(=O)CCOc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19ClN2O6/c1-10-2-3-11(16(21)22)9-18(10)15(20)6-7-25-14-5-4-12(17)8-13(14)19(23)24/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H,21,22) |
| InChIKey | NXWZZBZLMNQYPU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|