C14H19Cl2N3O4 — CID 119426675
3-(4-chloro-2-nitrophenoxy)-N-piperidin-3-ylpropanamide;hydrochloride (PubChem CID 119426675) has the molecular formula C14H19Cl2N3O4 and a molecular weight of 364.23 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrophenoxy)-N-piperidin-3-ylpropanamide;hydrochloride.
| Compound Name | 3-(4-chloro-2-nitrophenoxy)-N-piperidin-3-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119426675 |
| Molecular Formula | C14H19Cl2N3O4 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-(4-chloro-2-nitrophenoxy)-N-piperidin-3-ylpropanamide;hydrochloride |
| SMILES | Cl.O=C(CCOc1ccc(Cl)cc1[N+](=O)[O-])NC1CCCNC1 |
| InChI | InChI=1S/C14H18ClN3O4.ClH/c15-10-3-4-13(12(8-10)18(20)21)22-7-5-14(19)17-11-2-1-6-16-9-11;/h3-4,8,11,16H,1-2,5-7,9H2,(H,17,19);1H |
| InChIKey | WYVBZOWMZWSOII-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|