C14H15ClN2O6 — CID 119366270
(2S)-1-[3-(4-chloro-2-nitrophenoxy)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119366270) has the molecular formula C14H15ClN2O6 and a molecular weight of 342.74 g/mol. Its IUPAC name is (2S)-1-[3-(4-chloro-2-nitrophenoxy)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-(4-chloro-2-nitrophenoxy)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119366270 |
| Molecular Formula | C14H15ClN2O6 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (2S)-1-[3-(4-chloro-2-nitrophenoxy)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CCOc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15ClN2O6/c15-9-3-4-12(11(8-9)17(21)22)23-7-5-13(18)16-6-1-2-10(16)14(19)20/h3-4,8,10H,1-2,5-7H2,(H,19,20)/t10-/m0/s1 |
| InChIKey | GQONONNATKSGNO-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|