C14H15Cl2NO4 — CID 119365280
(2S)-1-[3-(2,4-dichlorophenoxy)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365280) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is (2S)-1-[3-(2,4-dichlorophenoxy)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-(2,4-dichlorophenoxy)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365280 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (2S)-1-[3-(2,4-dichlorophenoxy)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2NO4/c15-9-3-4-12(10(16)8-9)21-7-5-13(18)17-6-1-2-11(17)14(19)20/h3-4,8,11H,1-2,5-7H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | YMUUMRZSGUUJOT-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |