1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid

C14H17Cl2NO3 — CID 43440816

IUPAC1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(CCOc2ccc(Cl)cc2Cl)C1
InChIInChI=1S/C14H17Cl2NO3/c15-11-3-4-13(12(16)8-11)20-7-6-17-5-1-2-10(9-17)14(18)19/h3-4,8,10H,1-2,5-7,9H2,(H,18,19)
InChIKeyCCHFPKAFXPRSHG-UHFFFAOYSA-N
MW318.20 g/mol
LogP3.17
Rot. Bonds5

About 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid

1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid (PubChem CID 43440816) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid
PubChem CID43440816
Molecular FormulaC14H17Cl2NO3
Molecular Weight318.20 g/mol
Exact Mass317.06
IUPAC Name1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(CCOc2ccc(Cl)cc2Cl)C1
InChIInChI=1S/C14H17Cl2NO3/c15-11-3-4-13(12(16)8-11)20-7-6-17-5-1-2-10(9-17)14(18)19/h3-4,8,10H,1-2,5-7,9H2,(H,18,19)
InChIKeyCCHFPKAFXPRSHG-UHFFFAOYSA-N
XLogP3.17
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.20
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid?
The IUPAC name of 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid (CID 43440816) is 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid is O=C(O)C1CCCN(CCOc2ccc(Cl)cc2Cl)C1.
What is the InChIKey of 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid?
The InChIKey is CCHFPKAFXPRSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO3/c15-11-3-4-13(12(16)8-11)20-7-6-17-5-1-2-10(9-17)14(18)19/h3-4,8,10H,1-2,5-7,9H2,(H,18,19).
What are the key properties of 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid?
1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid has a molecular weight of 318.20 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 43440816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).