C14H17Cl2NO3 — CID 43440816
1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid (PubChem CID 43440816) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 43440816 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCOc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H17Cl2NO3/c15-11-3-4-13(12(16)8-11)20-7-6-17-5-1-2-10(9-17)14(18)19/h3-4,8,10H,1-2,5-7,9H2,(H,18,19) |
| InChIKey | CCHFPKAFXPRSHG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |