C14H18Cl2N2O3 — CID 91459026
[1-[2-(2,4-dichlorophenoxy)ethyl]piperidin-4-yl] carbamate (PubChem CID 91459026) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is [1-[2-(2,4-dichlorophenoxy)ethyl]piperidin-4-yl] carbamate.
| Compound Name | [1-[2-(2,4-dichlorophenoxy)ethyl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 91459026 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [1-[2-(2,4-dichlorophenoxy)ethyl]piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1CCN(CCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O3/c15-10-1-2-13(12(16)9-10)20-8-7-18-5-3-11(4-6-18)21-14(17)19/h1-2,9,11H,3-8H2,(H2,17,19) |
| InChIKey | HLRHGMISARKDAS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |