C15H21Cl2NO — CID 893166
(3R,5R)-1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine (PubChem CID 893166) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is (3R,5R)-1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine.
| Compound Name | (3R,5R)-1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 893166 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (3R,5R)-1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCOc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-11-7-12(2)10-18(9-11)5-6-19-15-4-3-13(16)8-14(15)17/h3-4,8,11-12H,5-7,9-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | OJXUTEQKYARIAE-VXGBXAGGSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |