C15H21Cl2NO2 — CID 2182592
(2S,6S)-4-[3-(2,5-dichlorophenoxy)propyl]-2,6-dimethylmorpholine (PubChem CID 2182592) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is (2S,6S)-4-[3-(2,5-dichlorophenoxy)propyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-[3-(2,5-dichlorophenoxy)propyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2182592 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (2S,6S)-4-[3-(2,5-dichlorophenoxy)propyl]-2,6-dimethylmorpholine |
| SMILES | C[C@H]1CN(CCCOc2cc(Cl)ccc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C15H21Cl2NO2/c1-11-9-18(10-12(2)20-11)6-3-7-19-15-8-13(16)4-5-14(15)17/h4-5,8,11-12H,3,6-7,9-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | LIKHRWUHHPZKIE-RYUDHWBXSA-N |
| XLogP | 3.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|