C18H28ClNO3 — CID 2934947
4-[2-[2-(4-chloro-2,3-dimethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine (PubChem CID 2934947) has the molecular formula C18H28ClNO3 and a molecular weight of 341.88 g/mol. Its IUPAC name is 4-[2-[2-(4-chloro-2,3-dimethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[2-[2-(4-chloro-2,3-dimethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2934947 |
| Molecular Formula | C18H28ClNO3 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-[2-[2-(4-chloro-2,3-dimethylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholine |
| SMILES | Cc1c(Cl)ccc(OCCOCCN2CC(C)OC(C)C2)c1C |
| InChI | InChI=1S/C18H28ClNO3/c1-13-11-20(12-14(2)23-13)7-8-21-9-10-22-18-6-5-17(19)15(3)16(18)4/h5-6,13-14H,7-12H2,1-4H3 |
| InChIKey | VQOTZXGWFNHLHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|