C17H26ClNO4 — CID 2993765
2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzaldehyde;hydrochloride (PubChem CID 2993765) has the molecular formula C17H26ClNO4 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzaldehyde;hydrochloride.
| Compound Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzaldehyde;hydrochloride |
|---|---|
| PubChem CID | 2993765 |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[2-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]ethoxy]benzaldehyde;hydrochloride |
| SMILES | CC1CN(CCOCCOc2ccccc2C=O)CC(C)O1.Cl |
| InChI | InChI=1S/C17H25NO4.ClH/c1-14-11-18(12-15(2)22-14)7-8-20-9-10-21-17-6-4-3-5-16(17)13-19;/h3-6,13-15H,7-12H2,1-2H3;1H |
| InChIKey | GFGAYIIKQSNGBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|