C17H24N2O3 — CID 7394111
2-[2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzonitrile (PubChem CID 7394111) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzonitrile.
| Compound Name | 2-[2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 7394111 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethoxy]ethoxy]benzonitrile |
| SMILES | C[C@H]1CN(CCOCCOc2ccccc2C#N)C[C@H](C)O1 |
| InChI | InChI=1S/C17H24N2O3/c1-14-12-19(13-15(2)22-14)7-8-20-9-10-21-17-6-4-3-5-16(17)11-18/h3-6,14-15H,7-10,12-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | JCQKHYUDESUQGK-GJZGRUSLSA-N |
| XLogP | 2.06 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|