C22H29NO3 — CID 7412761
(2R,6R)-2,6-dimethyl-4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine (PubChem CID 7412761) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 7412761 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[2-[2-(2-phenylphenoxy)ethoxy]ethyl]morpholine |
| SMILES | C[C@@H]1CN(CCOCCOc2ccccc2-c2ccccc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H29NO3/c1-18-16-23(17-19(2)26-18)12-13-24-14-15-25-22-11-7-6-10-21(22)20-8-4-3-5-9-20/h3-11,18-19H,12-17H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | MEXFMTUUBLFXRD-RTBURBONSA-N |
| XLogP | 3.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|