C24H31NO6 — CID 2936091
2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholine;oxalic acid (PubChem CID 2936091) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is 2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholine;oxalic acid.
| Compound Name | 2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 2936091 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2,6-dimethyl-4-[4-(2-phenylphenoxy)butyl]morpholine;oxalic acid |
| SMILES | CC1CN(CCCCOc2ccccc2-c2ccccc2)CC(C)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29NO2.C2H2O4/c1-18-16-23(17-19(2)25-18)14-8-9-15-24-22-13-7-6-12-21(22)20-10-4-3-5-11-20;3-1(4)2(5)6/h3-7,10-13,18-19H,8-9,14-17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WWJKOQYPBNCBIQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|