C18H26BrNO6 — CID 2934524
4-[4-(2-bromophenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid (PubChem CID 2934524) has the molecular formula C18H26BrNO6 and a molecular weight of 432.31 g/mol. Its IUPAC name is 4-[4-(2-bromophenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid.
| Compound Name | 4-[4-(2-bromophenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 2934524 |
| Molecular Formula | C18H26BrNO6 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-[4-(2-bromophenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid |
| SMILES | CC1CN(CCCCOc2ccccc2Br)CC(C)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H24BrNO2.C2H2O4/c1-13-11-18(12-14(2)20-13)9-5-6-10-19-16-8-4-3-7-15(16)17;3-1(4)2(5)6/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IAXRSSPITDPNQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|