C17H24N2O2 — CID 2996447
2-[4-(2,6-dimethylmorpholin-4-yl)butoxy]benzonitrile (PubChem CID 2996447) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylmorpholin-4-yl)butoxy]benzonitrile.
| Compound Name | 2-[4-(2,6-dimethylmorpholin-4-yl)butoxy]benzonitrile |
|---|---|
| PubChem CID | 2996447 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[4-(2,6-dimethylmorpholin-4-yl)butoxy]benzonitrile |
| SMILES | CC1CN(CCCCOc2ccccc2C#N)CC(C)O1 |
| InChI | InChI=1S/C17H24N2O2/c1-14-12-19(13-15(2)21-14)9-5-6-10-20-17-8-4-3-7-16(17)11-18/h3-4,7-8,14-15H,5-6,9-10,12-13H2,1-2H3 |
| InChIKey | MFVDANBNLQYMGT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|