C17H24N2O — CID 27186867
2-[3-[(3R,4R)-3,4-dimethylpiperidin-1-yl]propoxy]benzonitrile (PubChem CID 27186867) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[3-[(3R,4R)-3,4-dimethylpiperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 2-[3-[(3R,4R)-3,4-dimethylpiperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 27186867 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-[3-[(3R,4R)-3,4-dimethylpiperidin-1-yl]propoxy]benzonitrile |
| SMILES | C[C@@H]1CCN(CCCOc2ccccc2C#N)C[C@@H]1C |
| InChI | InChI=1S/C17H24N2O/c1-14-8-10-19(13-15(14)2)9-5-11-20-17-7-4-3-6-16(17)12-18/h3-4,6-7,14-15H,5,8-11,13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | PAWRRFRKPOTTGM-CABCVRRESA-N |
| XLogP | 3.31 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|