C13H16N2O3 — CID 106669436
2-[2-(3,4-dihydroxypyrrolidin-1-yl)ethoxy]benzonitrile (PubChem CID 106669436) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxypyrrolidin-1-yl)ethoxy]benzonitrile.
| Compound Name | 2-[2-(3,4-dihydroxypyrrolidin-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 106669436 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[2-(3,4-dihydroxypyrrolidin-1-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C13H16N2O3/c14-7-10-3-1-2-4-13(10)18-6-5-15-8-11(16)12(17)9-15/h1-4,11-12,16-17H,5-6,8-9H2 |
| InChIKey | IDRRDLRFVTWALP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |