C20H22FN3O — CID 86825032
2-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethoxy]benzonitrile (PubChem CID 86825032) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethoxy]benzonitrile.
| Compound Name | 2-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 86825032 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCN1CCCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O/c21-18-6-8-19(9-7-18)24-11-3-10-23(12-13-24)14-15-25-20-5-2-1-4-17(20)16-22/h1-2,4-9H,3,10-15H2 |
| InChIKey | PLVZARVOPQSRDJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |