C20H30ClNO6 — CID 2934960
4-[4-(4-chloro-2,3-dimethylphenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid (PubChem CID 2934960) has the molecular formula C20H30ClNO6 and a molecular weight of 415.91 g/mol. Its IUPAC name is 4-[4-(4-chloro-2,3-dimethylphenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid.
| Compound Name | 4-[4-(4-chloro-2,3-dimethylphenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 2934960 |
| Molecular Formula | C20H30ClNO6 |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-[4-(4-chloro-2,3-dimethylphenoxy)butyl]-2,6-dimethylmorpholine;oxalic acid |
| SMILES | Cc1c(Cl)ccc(OCCCCN2CC(C)OC(C)C2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H28ClNO2.C2H2O4/c1-13-11-20(12-14(2)22-13)9-5-6-10-21-18-8-7-17(19)15(3)16(18)4;3-1(4)2(5)6/h7-8,13-14H,5-6,9-12H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | DPGJORBAFPBUCU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|