C17H26ClNO2 — CID 2182666
(2R,6R)-4-[4-(2-chloro-5-methylphenoxy)butyl]-2,6-dimethylmorpholine (PubChem CID 2182666) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is (2R,6R)-4-[4-(2-chloro-5-methylphenoxy)butyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-[4-(2-chloro-5-methylphenoxy)butyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2182666 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2R,6R)-4-[4-(2-chloro-5-methylphenoxy)butyl]-2,6-dimethylmorpholine |
| SMILES | Cc1ccc(Cl)c(OCCCCN2C[C@@H](C)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C17H26ClNO2/c1-13-6-7-16(18)17(10-13)20-9-5-4-8-19-11-14(2)21-15(3)12-19/h6-7,10,14-15H,4-5,8-9,11-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | MOVOREHDXHWCSR-HUUCEWRRSA-N |
| XLogP | 3.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|