C17H27ClNO3+ — CID 2181771
(2R,6R)-4-[2-[2-(2-chloro-5-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2181771) has the molecular formula C17H27ClNO3+ and a molecular weight of 328.86 g/mol. Its IUPAC name is (2R,6R)-4-[2-[2-(2-chloro-5-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2R,6R)-4-[2-[2-(2-chloro-5-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2181771 |
| Molecular Formula | C17H27ClNO3+ |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2R,6R)-4-[2-[2-(2-chloro-5-methylphenoxy)ethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | Cc1ccc(Cl)c(OCCOCC[NH+]2C[C@@H](C)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C17H26ClNO3/c1-13-4-5-16(18)17(10-13)21-9-8-20-7-6-19-11-14(2)22-15(3)12-19/h4-5,10,14-15H,6-9,11-12H2,1-3H3/p+1/t14-,15-/m1/s1 |
| InChIKey | ALNUZSFHDONXIC-HUUCEWRRSA-O |
| XLogP | 1.74 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|