C20H32NO3+ — CID 2182900
(2R,6S)-2,6-dimethyl-4-[2-[2-(4-methyl-2-prop-2-enylphenoxy)ethoxy]ethyl]morpholin-4-ium (PubChem CID 2182900) has the molecular formula C20H32NO3+ and a molecular weight of 334.48 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-[2-[2-(4-methyl-2-prop-2-enylphenoxy)ethoxy]ethyl]morpholin-4-ium.
| Compound Name | (2R,6S)-2,6-dimethyl-4-[2-[2-(4-methyl-2-prop-2-enylphenoxy)ethoxy]ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 2182900 |
| Molecular Formula | C20H32NO3+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-[2-[2-(4-methyl-2-prop-2-enylphenoxy)ethoxy]ethyl]morpholin-4-ium |
| SMILES | C=CCc1cc(C)ccc1OCCOCC[NH+]1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C20H31NO3/c1-5-6-19-13-16(2)7-8-20(19)23-12-11-22-10-9-21-14-17(3)24-18(4)15-21/h5,7-8,13,17-18H,1,6,9-12,14-15H2,2-4H3/p+1/t17-,18+ |
| InChIKey | PIPKRWKAGGDCBT-HDICACEKSA-O |
| XLogP | 1.81 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|