C19H32N2O+2 — CID 2299280
1-methyl-4-[4-(4-methyl-2-prop-2-enylphenoxy)butyl]piperazine-1,4-diium (PubChem CID 2299280) has the molecular formula C19H32N2O+2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-methyl-4-[4-(4-methyl-2-prop-2-enylphenoxy)butyl]piperazine-1,4-diium.
| Compound Name | 1-methyl-4-[4-(4-methyl-2-prop-2-enylphenoxy)butyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 2299280 |
| Molecular Formula | C19H32N2O+2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 1-methyl-4-[4-(4-methyl-2-prop-2-enylphenoxy)butyl]piperazine-1,4-diium |
| SMILES | C=CCc1cc(C)ccc1OCCCC[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C19H30N2O/c1-4-7-18-16-17(2)8-9-19(18)22-15-6-5-10-21-13-11-20(3)12-14-21/h4,8-9,16H,1,5-7,10-15H2,2-3H3/p+2 |
| InChIKey | GQMVVRUTEPRJJO-UHFFFAOYSA-P |
| XLogP | 0.30 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|