C17H25N2O3+ — CID 7394525
4-[2-[2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]ethoxy]benzonitrile (PubChem CID 7394525) has the molecular formula C17H25N2O3+ and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[2-[2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]ethoxy]benzonitrile.
| Compound Name | 4-[2-[2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 7394525 |
| Molecular Formula | C17H25N2O3+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 4-[2-[2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]ethoxy]benzonitrile |
| SMILES | C[C@@H]1C[NH+](CCOCCOc2ccc(C#N)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C17H24N2O3/c1-14-12-19(13-15(2)22-14)7-8-20-9-10-21-17-5-3-16(11-18)4-6-17/h3-6,14-15H,7-10,12-13H2,1-2H3/p+1/t14-,15-/m1/s1 |
| InChIKey | AEAPCTLHARUWHE-HUUCEWRRSA-O |
| XLogP | 0.65 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|