C20H34NO3+ — CID 2183281
(3R,5R)-3,5-dimethyl-1-[2-[2-(4-propoxyphenoxy)ethoxy]ethyl]piperidin-1-ium (PubChem CID 2183281) has the molecular formula C20H34NO3+ and a molecular weight of 336.50 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-1-[2-[2-(4-propoxyphenoxy)ethoxy]ethyl]piperidin-1-ium.
| Compound Name | (3R,5R)-3,5-dimethyl-1-[2-[2-(4-propoxyphenoxy)ethoxy]ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2183281 |
| Molecular Formula | C20H34NO3+ |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-1-[2-[2-(4-propoxyphenoxy)ethoxy]ethyl]piperidin-1-ium |
| SMILES | CCCOc1ccc(OCCOCC[NH+]2C[C@H](C)C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C20H33NO3/c1-4-10-23-19-5-7-20(8-6-19)24-13-12-22-11-9-21-15-17(2)14-18(3)16-21/h5-8,17-18H,4,9-16H2,1-3H3/p+1/t17-,18-/m1/s1 |
| InChIKey | HPPAFXHZWSOYJV-QZTJIDSGSA-O |
| XLogP | 2.43 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|