C19H30NO2+ — CID 7380047
1-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]phenyl]ethanone (PubChem CID 7380047) has the molecular formula C19H30NO2+ and a molecular weight of 304.45 g/mol. Its IUPAC name is 1-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]phenyl]ethanone.
| Compound Name | 1-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 7380047 |
| Molecular Formula | C19H30NO2+ |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 1-[4-[4-[(3S,5R)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCC[NH+]2C[C@H](C)C[C@H](C)C2)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-15-12-16(2)14-20(13-15)10-4-5-11-22-19-8-6-18(7-9-19)17(3)21/h6-9,15-16H,4-5,10-14H2,1-3H3/p+1/t15-,16+ |
| InChIKey | WQQPEWWJJVZSMD-IYBDPMFKSA-O |
| XLogP | 2.61 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|