C19H32NO+ — CID 2300295
(3R,5R)-1-[4-(2,4-dimethylphenoxy)butyl]-3,5-dimethylpiperidin-1-ium (PubChem CID 2300295) has the molecular formula C19H32NO+ and a molecular weight of 290.47 g/mol. Its IUPAC name is (3R,5R)-1-[4-(2,4-dimethylphenoxy)butyl]-3,5-dimethylpiperidin-1-ium.
| Compound Name | (3R,5R)-1-[4-(2,4-dimethylphenoxy)butyl]-3,5-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 2300295 |
| Molecular Formula | C19H32NO+ |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | (3R,5R)-1-[4-(2,4-dimethylphenoxy)butyl]-3,5-dimethylpiperidin-1-ium |
| SMILES | Cc1ccc(OCCCC[NH+]2C[C@H](C)C[C@@H](C)C2)c(C)c1 |
| InChI | InChI=1S/C19H31NO/c1-15-7-8-19(18(4)12-15)21-10-6-5-9-20-13-16(2)11-17(3)14-20/h7-8,12,16-17H,5-6,9-11,13-14H2,1-4H3/p+1/t16-,17-/m1/s1 |
| InChIKey | UIOZNEORVGOKOX-IAGOWNOFSA-O |
| XLogP | 3.02 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|