C17H27N2O3+ — CID 2184740
(3S,5S)-3,5-dimethyl-1-[4-(2-nitrophenoxy)butyl]piperidin-1-ium (PubChem CID 2184740) has the molecular formula C17H27N2O3+ and a molecular weight of 307.41 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[4-(2-nitrophenoxy)butyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[4-(2-nitrophenoxy)butyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2184740 |
| Molecular Formula | C17H27N2O3+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[4-(2-nitrophenoxy)butyl]piperidin-1-ium |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CCCCOc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H26N2O3/c1-14-11-15(2)13-18(12-14)9-5-6-10-22-17-8-4-3-7-16(17)19(20)21/h3-4,7-8,14-15H,5-6,9-13H2,1-2H3/p+1/t14-,15-/m0/s1 |
| InChIKey | USZVBVQZZIMENQ-GJZGRUSLSA-O |
| XLogP | 2.31 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|