C16H25N2O3+ — CID 7412650
(3S,5S)-3,5-dimethyl-1-[2-(3-methyl-4-nitrophenoxy)ethyl]piperidin-1-ium (PubChem CID 7412650) has the molecular formula C16H25N2O3+ and a molecular weight of 293.39 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[2-(3-methyl-4-nitrophenoxy)ethyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[2-(3-methyl-4-nitrophenoxy)ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7412650 |
| Molecular Formula | C16H25N2O3+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[2-(3-methyl-4-nitrophenoxy)ethyl]piperidin-1-ium |
| SMILES | Cc1cc(OCC[NH+]2C[C@@H](C)C[C@H](C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N2O3/c1-12-8-13(2)11-17(10-12)6-7-21-15-4-5-16(18(19)20)14(3)9-15/h4-5,9,12-13H,6-8,10-11H2,1-3H3/p+1/t12-,13-/m0/s1 |
| InChIKey | WYOPNAZNNNWSQM-STQMWFEESA-O |
| XLogP | 1.84 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|