C16H25N2O4+ — CID 2181659
(2R,6R)-2,6-dimethyl-4-[3-(3-methyl-4-nitrophenoxy)propyl]morpholin-4-ium (PubChem CID 2181659) has the molecular formula C16H25N2O4+ and a molecular weight of 309.39 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[3-(3-methyl-4-nitrophenoxy)propyl]morpholin-4-ium.
| Compound Name | (2R,6R)-2,6-dimethyl-4-[3-(3-methyl-4-nitrophenoxy)propyl]morpholin-4-ium |
|---|---|
| PubChem CID | 2181659 |
| Molecular Formula | C16H25N2O4+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[3-(3-methyl-4-nitrophenoxy)propyl]morpholin-4-ium |
| SMILES | Cc1cc(OCCC[NH+]2C[C@@H](C)O[C@H](C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N2O4/c1-12-9-15(5-6-16(12)18(19)20)21-8-4-7-17-10-13(2)22-14(3)11-17/h5-6,9,13-14H,4,7-8,10-11H2,1-3H3/p+1/t13-,14-/m1/s1 |
| InChIKey | BZSBSMFOOFLYCY-ZIAGYGMSSA-O |
| XLogP | 1.36 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|