C20H28NO2+ — CID 2184565
(2R,6R)-2,6-dimethyl-4-(4-naphthalen-2-yloxybutyl)morpholin-4-ium (PubChem CID 2184565) has the molecular formula C20H28NO2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(4-naphthalen-2-yloxybutyl)morpholin-4-ium.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(4-naphthalen-2-yloxybutyl)morpholin-4-ium |
|---|---|
| PubChem CID | 2184565 |
| Molecular Formula | C20H28NO2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(4-naphthalen-2-yloxybutyl)morpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCCCOc2ccc3ccccc3c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H27NO2/c1-16-14-21(15-17(2)23-16)11-5-6-12-22-20-10-9-18-7-3-4-8-19(18)13-20/h3-4,7-10,13,16-17H,5-6,11-12,14-15H2,1-2H3/p+1/t16-,17-/m1/s1 |
| InChIKey | JPRKCHDIHWKMEU-IAGOWNOFSA-O |
| XLogP | 2.69 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|