C19H25ClNO2+ — CID 2183058
(2R,6S)-4-[3-(4-chloronaphthalen-1-yl)oxypropyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2183058) has the molecular formula C19H25ClNO2+ and a molecular weight of 334.87 g/mol. Its IUPAC name is (2R,6S)-4-[3-(4-chloronaphthalen-1-yl)oxypropyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2R,6S)-4-[3-(4-chloronaphthalen-1-yl)oxypropyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2183058 |
| Molecular Formula | C19H25ClNO2+ |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2R,6S)-4-[3-(4-chloronaphthalen-1-yl)oxypropyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCCOc2ccc(Cl)c3ccccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C19H24ClNO2/c1-14-12-21(13-15(2)23-14)10-5-11-22-19-9-8-18(20)16-6-3-4-7-17(16)19/h3-4,6-9,14-15H,5,10-13H2,1-2H3/p+1/t14-,15+ |
| InChIKey | LBXLFNZMNYGFSZ-GASCZTMLSA-O |
| XLogP | 2.95 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|