C15H21N2O2+ — CID 7393960
2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]benzonitrile (PubChem CID 7393960) has the molecular formula C15H21N2O2+ and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]benzonitrile.
| Compound Name | 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 7393960 |
| Molecular Formula | C15H21N2O2+ |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-[2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]ethoxy]benzonitrile |
| SMILES | C[C@@H]1C[NH+](CCOc2ccccc2C#N)C[C@H](C)O1 |
| InChI | InChI=1S/C15H20N2O2/c1-12-10-17(11-13(2)19-12)7-8-18-15-6-4-3-5-14(15)9-16/h3-6,12-13H,7-8,10-11H2,1-2H3/p+1/t12-,13+ |
| InChIKey | UPBUUBKGTWLEEZ-BETUJISGSA-O |
| XLogP | 0.63 |
| TPSA | 46.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |