C16H25N3O2+2 — CID 7380430
2-[2-[2-(4-methylpiperazine-1,4-diium-1-yl)ethoxy]ethoxy]benzonitrile (PubChem CID 7380430) has the molecular formula C16H25N3O2+2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-[2-(4-methylpiperazine-1,4-diium-1-yl)ethoxy]ethoxy]benzonitrile.
| Compound Name | 2-[2-[2-(4-methylpiperazine-1,4-diium-1-yl)ethoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 7380430 |
| Molecular Formula | C16H25N3O2+2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-[2-[2-(4-methylpiperazine-1,4-diium-1-yl)ethoxy]ethoxy]benzonitrile |
| SMILES | C[NH+]1CC[NH+](CCOCCOc2ccccc2C#N)CC1 |
| InChI | InChI=1S/C16H23N3O2/c1-18-6-8-19(9-7-18)10-11-20-12-13-21-16-5-3-2-4-15(16)14-17/h2-5H,6-13H2,1H3/p+2 |
| InChIKey | YECXSSQVSHJXKX-UHFFFAOYSA-P |
| XLogP | -1.63 |
| TPSA | 51.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|