C15H25BrN2O2+2 — CID 2581089
1-[2-[2-(3-bromophenoxy)ethoxy]ethyl]-4-methylpiperazine-1,4-diium (PubChem CID 2581089) has the molecular formula C15H25BrN2O2+2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-[2-[2-(3-bromophenoxy)ethoxy]ethyl]-4-methylpiperazine-1,4-diium.
| Compound Name | 1-[2-[2-(3-bromophenoxy)ethoxy]ethyl]-4-methylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 2581089 |
| Molecular Formula | C15H25BrN2O2+2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[2-[2-(3-bromophenoxy)ethoxy]ethyl]-4-methylpiperazine-1,4-diium |
| SMILES | C[NH+]1CC[NH+](CCOCCOc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-17-5-7-18(8-6-17)9-10-19-11-12-20-15-4-2-3-14(16)13-15/h2-4,13H,5-12H2,1H3/p+2 |
| InChIKey | AEHZNCWQHCBLAA-UHFFFAOYSA-P |
| XLogP | -0.74 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|