C19H34N2O2+2 — CID 2296803
1-methyl-4-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperazine-1,4-diium (PubChem CID 2296803) has the molecular formula C19H34N2O2+2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-methyl-4-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperazine-1,4-diium.
| Compound Name | 1-methyl-4-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 2296803 |
| Molecular Formula | C19H34N2O2+2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 1-methyl-4-[2-[2-(3-methyl-5-propan-2-ylphenoxy)ethoxy]ethyl]piperazine-1,4-diium |
| SMILES | Cc1cc(OCCOCC[NH+]2CC[NH+](C)CC2)cc(C(C)C)c1 |
| InChI | InChI=1S/C19H32N2O2/c1-16(2)18-13-17(3)14-19(15-18)23-12-11-22-10-9-21-7-5-20(4)6-8-21/h13-16H,5-12H2,1-4H3/p+2 |
| InChIKey | WHTNWXCLOHQIBX-UHFFFAOYSA-P |
| XLogP | -0.07 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|