C16H27N3O4+2 — CID 2582699
1-methyl-4-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethyl]piperazine-1,4-diium (PubChem CID 2582699) has the molecular formula C16H27N3O4+2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-methyl-4-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethyl]piperazine-1,4-diium.
| Compound Name | 1-methyl-4-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 2582699 |
| Molecular Formula | C16H27N3O4+2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-methyl-4-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethyl]piperazine-1,4-diium |
| SMILES | Cc1ccc(OCCOCC[NH+]2CC[NH+](C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N3O4/c1-14-3-4-16(15(13-14)19(20)21)23-12-11-22-10-9-18-7-5-17(2)6-8-18/h3-4,13H,5-12H2,1-2H3/p+2 |
| InChIKey | MRAAMPCOEUCAAU-UHFFFAOYSA-P |
| XLogP | -1.29 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|