C15H13Cl2NO4 — CID 57398735
1-[2-(2,4-dichlorophenoxy)ethoxy]-4-methyl-2-nitrobenzene (PubChem CID 57398735) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethoxy]-4-methyl-2-nitrobenzene.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethoxy]-4-methyl-2-nitrobenzene |
|---|---|
| PubChem CID | 57398735 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethoxy]-4-methyl-2-nitrobenzene |
| SMILES | Cc1ccc(OCCOc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13Cl2NO4/c1-10-2-4-15(13(8-10)18(19)20)22-7-6-21-14-5-3-11(16)9-12(14)17/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | AJEOGSBQKWOWOV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|