C15H21NO8 — CID 161317064
2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 161317064) has the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 161317064 |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | Cc1ccc(OCCOCCOCCOCC(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21NO8/c1-12-2-3-14(13(10-12)16(19)20)24-9-8-22-5-4-21-6-7-23-11-15(17)18/h2-3,10H,4-9,11H2,1H3,(H,17,18) |
| InChIKey | FALYOWZNAUYVRR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|