C17H26N2O7 — CID 161317067
N-ethyl-2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 161317067) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-ethyl-2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | N-ethyl-2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 161317067 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-ethyl-2-[2-[2-[2-(4-methyl-2-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | CCNC(=O)COCCOCCOCCOc1ccc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O7/c1-3-18-17(20)13-25-9-8-23-6-7-24-10-11-26-16-5-4-14(2)12-15(16)19(21)22/h4-5,12H,3,6-11,13H2,1-2H3,(H,18,20) |
| InChIKey | WBASVWUFVHKMBC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|