C18H14Cl2N4O4 — CID 19270157
1-[(2,4-dichlorophenoxy)methyl]-N-(4-methyl-2-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19270157) has the molecular formula C18H14Cl2N4O4 and a molecular weight of 421.24 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenoxy)methyl]-N-(4-methyl-2-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenoxy)methyl]-N-(4-methyl-2-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270157 |
| Molecular Formula | C18H14Cl2N4O4 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 1-[(2,4-dichlorophenoxy)methyl]-N-(4-methyl-2-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccn(COc3ccc(Cl)cc3Cl)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14Cl2N4O4/c1-11-2-4-14(16(8-11)24(26)27)21-18(25)15-6-7-23(22-15)10-28-17-5-3-12(19)9-13(17)20/h2-9H,10H2,1H3,(H,21,25) |
| InChIKey | ROXYOALDCLTQOI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|