C18H15Cl2N3O3 — CID 19275548
N-(5-chloro-2-hydroxyphenyl)-1-[(2-chloro-5-methylphenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19275548) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-[(2-chloro-5-methylphenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-[(2-chloro-5-methylphenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19275548 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-[(2-chloro-5-methylphenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(Cl)c(OCn2ccc(C(=O)Nc3cc(Cl)ccc3O)n2)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-11-2-4-13(20)17(8-11)26-10-23-7-6-14(22-23)18(25)21-15-9-12(19)3-5-16(15)24/h2-9,24H,10H2,1H3,(H,21,25) |
| InChIKey | AZOXUJFRKCZIDP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|