C17H14ClN3O3 — CID 19271046
N-(5-chloro-2-hydroxyphenyl)-1-(phenoxymethyl)pyrazole-3-carboxamide (PubChem CID 19271046) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-1-(phenoxymethyl)pyrazole-3-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-1-(phenoxymethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271046 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-1-(phenoxymethyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1ccn(COc2ccccc2)n1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-12-6-7-16(22)15(10-12)19-17(23)14-8-9-21(20-14)11-24-13-4-2-1-3-5-13/h1-10,22H,11H2,(H,19,23) |
| InChIKey | WZQDFTBOVPCIKN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|