C16H14N4O2 — CID 19271051
1-(phenoxymethyl)-N-pyridin-4-ylpyrazole-3-carboxamide (PubChem CID 19271051) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-(phenoxymethyl)-N-pyridin-4-ylpyrazole-3-carboxamide.
| Compound Name | 1-(phenoxymethyl)-N-pyridin-4-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271051 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-(phenoxymethyl)-N-pyridin-4-ylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1ccn(COc2ccccc2)n1 |
| InChI | InChI=1S/C16H14N4O2/c21-16(18-13-6-9-17-10-7-13)15-8-11-20(19-15)12-22-14-4-2-1-3-5-14/h1-11H,12H2,(H,17,18,21) |
| InChIKey | KHZAHHZZVSGZME-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |