C22H24ClN3O3 — CID 19275598
1-[(2-chloro-5-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)pyrazole-3-carboxamide (PubChem CID 19275598) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 1-[(2-chloro-5-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-5-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19275598 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[(2-chloro-5-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(Cl)c(OCn2ccc(C(=O)Nc3cc(C(C)C)c(O)cc3C)n2)c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-13(2)16-11-19(15(4)10-20(16)27)24-22(28)18-7-8-26(25-18)12-29-21-9-14(3)5-6-17(21)23/h5-11,13,27H,12H2,1-4H3,(H,24,28) |
| InChIKey | DXPPEBNTLINIKA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|